dimethyl (R*,R*)-tartrate


dimethyl dl-tartarate; dl-dimethyl tartarate; (±)-dimethyl tartrate; dimethyl rac-tartrate; dimethyl (R*,R*)-tartrate; methyl dl-tartarate
Formula:C6H10O6; 178.14 g/mol
InChiKey:PVRATXCXJDHJJN-QWWZWVQMSA-N
SMILES:COC(=O)[C@H](O)[C@@H](O)C(=O)OC
Molecular structure of dimethyl (R*,R*)-tartrate
Dipole moment:2.95 D
Melting point:90 °C
Boiling point:282 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature

Isomers

Molecular structure of dimethyl (2S,3S)-2,3-dihydroxybutanedioate
Molecular structure of dimethyl (2S,3S)-2,3-dihydroxybutanedioate
diethyl peroxydicarbonate
Molecular structure of diethyl peroxydicarbonate
dimethyl (2S,3S)-2,3-dihydroxybutanedioate
Molecular structure of dimethyl (2S,3S)-2,3-dihydroxybutanedioate
dimethyl (2S,3S)-2,3-dihydroxybutanedioate
Molecular structure of dimethyl (2S,3S)-2,3-dihydroxybutanedioate
dimethyl (R*,R*)-tartrate
Molecular structure of dimethyl (R*,R*)-tartrate
2,2'-[ethylenebis(oxy)] bisacetic acid
Molecular structure of 2,2'-[ethylenebis(oxy)] bisacetic acid
gluconolactone
Molecular structure of gluconolactone
D-gulonic acid γ-lactone
Molecular structure of D-gulonic acid g-lactone
L-gulonic acid γ-lactone
Molecular structure of L-gulonic acid g-lactone